C9H7Br2F3O2S — CID 103206591
1-(2,5-dibromothiophen-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206591) has the molecular formula C9H7Br2F3O2S and a molecular weight of 396.02 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206591 |
| Molecular Formula | C9H7Br2F3O2S |
| Molecular Weight | 396.02 g/mol |
| Exact Mass | 393.85 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H7Br2F3O2S/c10-7-3-5(8(11)17-7)6(15)1-2-16-4-9(12,13)14/h3H,1-2,4H2 |
| InChIKey | WDWUNSPKJBYKNG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|