C9H11F2NO2 — CID 103206683
3-(2,2-difluoroethoxy)-1-(1H-pyrrol-2-yl)propan-1-one (PubChem CID 103206683) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-2-yl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 103206683 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-2-yl)propan-1-one |
| SMILES | O=C(CCOCC(F)F)c1ccc[nH]1 |
| InChI | InChI=1S/C9H11F2NO2/c10-9(11)6-14-5-3-8(13)7-2-1-4-12-7/h1-2,4,9,12H,3,5-6H2 |
| InChIKey | UNYXLPKFOBGONN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|