C12H21F2N5O — CID 103206995
1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-3-amine (PubChem CID 103206995) has the molecular formula C12H21F2N5O and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-3-amine.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 103206995 |
| Molecular Formula | C12H21F2N5O |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-3-amine |
| SMILES | CC1CCN(c2n[nH]c(CCOCC(F)F)n2)CC1N |
| InChI | InChI=1S/C12H21F2N5O/c1-8-2-4-19(6-9(8)15)12-16-11(17-18-12)3-5-20-7-10(13)14/h8-10H,2-7,15H2,1H3,(H,16,17,18) |
| InChIKey | HYGOUULNHAQNFM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|