C12H20F3N5O — CID 103206997
4-methyl-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-amine (PubChem CID 103206997) has the molecular formula C12H20F3N5O and a molecular weight of 307.32 g/mol. Its IUPAC name is 4-methyl-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-amine.
| Compound Name | 4-methyl-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 103206997 |
| Molecular Formula | C12H20F3N5O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-methyl-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-amine |
| SMILES | CC1CCN(c2n[nH]c(CCOCC(F)(F)F)n2)CC1N |
| InChI | InChI=1S/C12H20F3N5O/c1-8-2-4-20(6-9(8)16)11-17-10(18-19-11)3-5-21-7-12(13,14)15/h8-9H,2-7,16H2,1H3,(H,17,18,19) |
| InChIKey | GWCRVISHVXKSHL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|