C12H20F3N5O — CID 103207010
[1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine (PubChem CID 103207010) has the molecular formula C12H20F3N5O and a molecular weight of 307.32 g/mol. Its IUPAC name is [1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine.
| Compound Name | [1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 103207010 |
| Molecular Formula | C12H20F3N5O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(c2n[nH]c(CCOCC(F)(F)F)n2)C1 |
| InChI | InChI=1S/C12H20F3N5O/c13-12(14,15)8-21-5-3-10-17-11(19-18-10)20-4-1-2-9(6-16)7-20/h9H,1-8,16H2,(H,17,18,19) |
| InChIKey | FRDXZUQQQDQZQG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|