C13H23F2N5O — CID 103207017
[1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-4-yl]methanamine (PubChem CID 103207017) has the molecular formula C13H23F2N5O and a molecular weight of 303.36 g/mol. Its IUPAC name is [1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-4-yl]methanamine.
| Compound Name | [1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 103207017 |
| Molecular Formula | C13H23F2N5O |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | [1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-4-methylpiperidin-4-yl]methanamine |
| SMILES | CC1(CN)CCN(c2n[nH]c(CCOCC(F)F)n2)CC1 |
| InChI | InChI=1S/C13H23F2N5O/c1-13(9-16)3-5-20(6-4-13)12-17-11(18-19-12)2-7-21-8-10(14)15/h10H,2-9,16H2,1H3,(H,17,18,19) |
| InChIKey | LQQUZPCYKWXQSG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|