About 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol
3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol (PubChem CID 103207403) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol |
| PubChem CID | 103207403 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(CNC2=NCCN2)C1 |
| InChI | InChI=1S/C9H17N3O/c13-8-2-1-7(5-8)6-12-9-10-3-4-11-9/h7-8,13H,1-6H2,(H2,10,11,12) |
| InChIKey | PASRICFOZRBOHU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol?
The IUPAC name of 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol (CID 103207403) is 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol.
What is the SMILES notation for 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol?
The canonical SMILES for 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol is OC1CCC(CNC2=NCCN2)C1.
What is the InChIKey of 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol?
The InChIKey is PASRICFOZRBOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c13-8-2-1-7(5-8)6-12-9-10-3-4-11-9/h7-8,13H,1-6H2,(H2,10,11,12).
What are the key properties of 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol?
3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol has a molecular weight of 183.25 g/mol, XLogP of -0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]cyclopentan-1-ol is sourced from PubChem (CID 103207403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).