C12H13BrF3N3O2 — CID 103207562
5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-6-bromo-1,3-dihydrobenzimidazol-2-one (PubChem CID 103207562) has the molecular formula C12H13BrF3N3O2 and a molecular weight of 368.15 g/mol. Its IUPAC name is 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-6-bromo-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-6-bromo-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103207562 |
| Molecular Formula | C12H13BrF3N3O2 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-6-bromo-1,3-dihydrobenzimidazol-2-one |
| SMILES | NC(CCOCC(F)(F)F)c1cc2[nH]c(=O)[nH]c2cc1Br |
| InChI | InChI=1S/C12H13BrF3N3O2/c13-7-4-10-9(18-11(20)19-10)3-6(7)8(17)1-2-21-5-12(14,15)16/h3-4,8H,1-2,5,17H2,(H2,18,19,20) |
| InChIKey | RUYBCYAHCXBPGT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|