C13H16BrF2N3O2 — CID 103207564
5-bromo-6-[3-(2,2-difluoroethoxy)-1-(methylamino)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103207564) has the molecular formula C13H16BrF2N3O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 5-bromo-6-[3-(2,2-difluoroethoxy)-1-(methylamino)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[3-(2,2-difluoroethoxy)-1-(methylamino)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103207564 |
| Molecular Formula | C13H16BrF2N3O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 5-bromo-6-[3-(2,2-difluoroethoxy)-1-(methylamino)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CNC(CCOCC(F)F)c1cc2[nH]c(=O)[nH]c2cc1Br |
| InChI | InChI=1S/C13H16BrF2N3O2/c1-17-9(2-3-21-6-12(15)16)7-4-10-11(5-8(7)14)19-13(20)18-10/h4-5,9,12,17H,2-3,6H2,1H3,(H2,18,19,20) |
| InChIKey | HPHUEUALDTXQNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|