About N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine
N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine (PubChem CID 103208170) has the molecular formula C12H26F2N2O
and a molecular weight of 252.35 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine |
| PubChem CID | 103208170 |
| Molecular Formula | C12H26F2N2O |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CNCCCNCCCOCC(F)F |
| InChI | InChI=1S/C12H26F2N2O/c1-11(2)9-16-6-3-5-15-7-4-8-17-10-12(13)14/h11-12,15-16H,3-10H2,1-2H3 |
| InChIKey | HIHYQMQJJDQTQY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine?
The IUPAC name of N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine (CID 103208170) is N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine.
What is the SMILES notation for N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine?
The canonical SMILES for N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine is CC(C)CNCCCNCCCOCC(F)F.
What is the InChIKey of N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine?
The InChIKey is HIHYQMQJJDQTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26F2N2O/c1-11(2)9-16-6-3-5-15-7-4-8-17-10-12(13)14/h11-12,15-16H,3-10H2,1-2H3.
What are the key properties of N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine?
N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine has a molecular weight of 252.35 g/mol, XLogP of 1.88, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,2-difluoroethoxy)propyl]-N'-(2-methylpropyl)propane-1,3-diamine is sourced from PubChem (CID 103208170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).