C8H13F3N2O2S — CID 103208320
N-(1-amino-1-sulfanylidenepropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103208320) has the molecular formula C8H13F3N2O2S and a molecular weight of 258.26 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208320 |
| Molecular Formula | C8H13F3N2O2S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(NC(=O)CCOCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C8H13F3N2O2S/c1-5(7(12)16)13-6(14)2-3-15-4-8(9,10)11/h5H,2-4H2,1H3,(H2,12,16)(H,13,14) |
| InChIKey | PSCTYQUGFNFQDT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|