C20H37FN2O5S — CID 10320845
(2S,4R)-4-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 10320845) has the molecular formula C20H37FN2O5S and a molecular weight of 436.59 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10320845 |
| Molecular Formula | C20H37FN2O5S |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (2S,4R)-4-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@H](CCCCF)CCN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H37FN2O5S/c1-11(2)14(18-16(25)15(24)17(26)20(28-18)29-3)23-19(27)13-10-12(7-9-22-13)6-4-5-8-21/h11-18,20,22,24-26H,4-10H2,1-3H3,(H,23,27)/t12-,13+,14-,15+,16-,17-,18-,20-/m1/s1 |
| InChIKey | UPDFGXVCDZRRSP-IFDHCQPASA-N |
| XLogP | 0.81 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|