C10H13F3N4O2S — CID 103208465
N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103208465) has the molecular formula C10H13F3N4O2S and a molecular weight of 310.30 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208465 |
| Molecular Formula | C10H13F3N4O2S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | Cn1ncc(C(N)=S)c1NC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O2S/c1-17-9(6(4-15-17)8(14)20)16-7(18)2-3-19-5-10(11,12)13/h4H,2-3,5H2,1H3,(H2,14,20)(H,16,18) |
| InChIKey | BMMQBRGMEPPONH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|