About N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide
N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208688) has the molecular formula C8H14ClF2NO2
and a molecular weight of 229.65 g/mol. Its IUPAC name is N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide |
| PubChem CID | 103208688 |
| Molecular Formula | C8H14ClF2NO2 |
| Molecular Weight | 229.65 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)F)NCCCCl |
| InChI | InChI=1S/C8H14ClF2NO2/c9-3-1-4-12-8(13)2-5-14-6-7(10)11/h7H,1-6H2,(H,12,13) |
| InChIKey | UFLDVWDAENXFDT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide?
The IUPAC name of N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide (CID 103208688) is N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide.
What is the SMILES notation for N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide?
The canonical SMILES for N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide is O=C(CCOCC(F)F)NCCCCl.
What is the InChIKey of N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide?
The InChIKey is UFLDVWDAENXFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClF2NO2/c9-3-1-4-12-8(13)2-5-14-6-7(10)11/h7H,1-6H2,(H,12,13).
What are the key properties of N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide?
N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide has a molecular weight of 229.65 g/mol, XLogP of 1.40, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-3-(2,2-difluoroethoxy)propanamide is sourced from PubChem (CID 103208688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).