C9H14F3N3O — CID 103208740
5-propyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole (PubChem CID 103208740) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is 5-propyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole.
| Compound Name | 5-propyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 103208740 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 5-propyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole |
| SMILES | CCCc1nc(CCOCC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C9H14F3N3O/c1-2-3-7-13-8(15-14-7)4-5-16-6-9(10,11)12/h2-6H2,1H3,(H,13,14,15) |
| InChIKey | VZEIJMCHWYICKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|