C10H10ClF3N4O — CID 103208767
7-chloro-5-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 103208767) has the molecular formula C10H10ClF3N4O and a molecular weight of 294.66 g/mol. Its IUPAC name is 7-chloro-5-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-chloro-5-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 103208767 |
| Molecular Formula | C10H10ClF3N4O |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 7-chloro-5-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | Cc1nc(Cl)cc2nnc(CCOCC(F)(F)F)n12 |
| InChI | InChI=1S/C10H10ClF3N4O/c1-6-15-7(11)4-9-17-16-8(18(6)9)2-3-19-5-10(12,13)14/h4H,2-3,5H2,1H3 |
| InChIKey | ONKFUDZRAHOHDE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|