C11H21F2NO3 — CID 103209026
3-(2,2-difluoroethoxy)-N-(1-hydroxy-4-methylpentan-2-yl)propanamide (PubChem CID 103209026) has the molecular formula C11H21F2NO3 and a molecular weight of 253.29 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(1-hydroxy-4-methylpentan-2-yl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(1-hydroxy-4-methylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 103209026 |
| Molecular Formula | C11H21F2NO3 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(1-hydroxy-4-methylpentan-2-yl)propanamide |
| SMILES | CC(C)CC(CO)NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C11H21F2NO3/c1-8(2)5-9(6-15)14-11(16)3-4-17-7-10(12)13/h8-10,15H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | NWAKIYNPUKHFSC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|