About 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide
3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide (PubChem CID 103209153) has the molecular formula C9H17F2NO4
and a molecular weight of 241.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide |
| PubChem CID | 103209153 |
| Molecular Formula | C9H17F2NO4 |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide |
| SMILES | CC(CO)(CO)NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H17F2NO4/c1-9(5-13,6-14)12-8(15)2-3-16-4-7(10)11/h7,13-14H,2-6H2,1H3,(H,12,15) |
| InChIKey | KBPVPZMPAOJDMW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide?
The IUPAC name of 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide (CID 103209153) is 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide?
The canonical SMILES for 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide is CC(CO)(CO)NC(=O)CCOCC(F)F.
What is the InChIKey of 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide?
The InChIKey is KBPVPZMPAOJDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO4/c1-9(5-13,6-14)12-8(15)2-3-16-4-7(10)11/h7,13-14H,2-6H2,1H3,(H,12,15).
What are the key properties of 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide?
3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide has a molecular weight of 241.23 g/mol, XLogP of -0.48, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-N-(1,3-dihydroxy-2-methylpropan-2-yl)propanamide is sourced from PubChem (CID 103209153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).