C9H17F2NO3 — CID 103209157
3-(2,2-difluoroethoxy)-N-(4-hydroxybutan-2-yl)propanamide (PubChem CID 103209157) has the molecular formula C9H17F2NO3 and a molecular weight of 225.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(4-hydroxybutan-2-yl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(4-hydroxybutan-2-yl)propanamide |
|---|---|
| PubChem CID | 103209157 |
| Molecular Formula | C9H17F2NO3 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(4-hydroxybutan-2-yl)propanamide |
| SMILES | CC(CCO)NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H17F2NO3/c1-7(2-4-13)12-9(14)3-5-15-6-8(10)11/h7-8,13H,2-6H2,1H3,(H,12,14) |
| InChIKey | TZHULLBNKMMGMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|