About N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide
N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103209173) has the molecular formula C8H14F3NO3
and a molecular weight of 229.20 g/mol. Its IUPAC name is N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide.
Molecular Properties
| Compound Name | N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| PubChem CID | 103209173 |
| Molecular Formula | C8H14F3NO3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCC(O)CNC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO3/c1-2-6(13)3-12-7(14)4-15-5-8(9,10)11/h6,13H,2-5H2,1H3,(H,12,14) |
| InChIKey | UVBALUYZEHECRY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide?
The IUPAC name of N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide (CID 103209173) is N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide.
What is the SMILES notation for N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide?
The canonical SMILES for N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide is CCC(O)CNC(=O)COCC(F)(F)F.
What is the InChIKey of N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide?
The InChIKey is UVBALUYZEHECRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO3/c1-2-6(13)3-12-7(14)4-15-5-8(9,10)11/h6,13H,2-5H2,1H3,(H,12,14).
What are the key properties of N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide?
N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide has a molecular weight of 229.20 g/mol, XLogP of 0.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxybutyl)-2-(2,2,2-trifluoroethoxy)acetamide is sourced from PubChem (CID 103209173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).