C11H18F2N2O3 — CID 103209266
4-[3-(2,2-difluoroethoxy)propanoyl]-3,3-dimethylpiperazin-2-one (PubChem CID 103209266) has the molecular formula C11H18F2N2O3 and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-[3-(2,2-difluoroethoxy)propanoyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[3-(2,2-difluoroethoxy)propanoyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 103209266 |
| Molecular Formula | C11H18F2N2O3 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[3-(2,2-difluoroethoxy)propanoyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C11H18F2N2O3/c1-11(2)10(17)14-4-5-15(11)9(16)3-6-18-7-8(12)13/h8H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | RIERWMPZYIRUOD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|