C11H18F2N2O2 — CID 103209322
1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103209322) has the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. Its IUPAC name is 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103209322 |
| Molecular Formula | C11H18F2N2O2 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C11H18F2N2O2/c12-10(13)7-17-4-2-11(16)15-3-1-8-5-14-6-9(8)15/h8-10,14H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | JHLBLAXSJPSKSY-DTWKUNHWSA-N |
| XLogP | 0.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|