C10H15F3N2O2 — CID 103209323
1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103209323) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103209323 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)(F)F)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H15F3N2O2/c11-10(12,13)6-17-5-9(16)15-2-1-7-3-14-4-8(7)15/h7-8,14H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | NFKDOUYNUJEMKP-JGVFFNPUSA-N |
| XLogP | 0.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |