About 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid
1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid (PubChem CID 103209532) has the molecular formula C9H13F3N2O4
and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid |
| PubChem CID | 103209532 |
| Molecular Formula | C9H13F3N2O4 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1C(=O)COCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O4/c10-9(11,12)5-18-4-7(15)14-2-1-13-3-6(14)8(16)17/h6,13H,1-5H2,(H,16,17) |
| InChIKey | POLTZKRRRRUPMA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid?
The IUPAC name of 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid (CID 103209532) is 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid.
What is the SMILES notation for 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid?
The canonical SMILES for 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid is O=C(O)C1CNCCN1C(=O)COCC(F)(F)F.
What is the InChIKey of 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid?
The InChIKey is POLTZKRRRRUPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O4/c10-9(11,12)5-18-4-7(15)14-2-1-13-3-6(14)8(16)17/h6,13H,1-5H2,(H,16,17).
What are the key properties of 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid?
1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid has a molecular weight of 270.21 g/mol, XLogP of -0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2,2-trifluoroethoxy)acetyl]piperazine-2-carboxylic acid is sourced from PubChem (CID 103209532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).