C12H19F3N2O2 — CID 103209594
1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103209594) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103209594 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC1C2CNCC2CN1C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O2/c1-8-10-5-16-4-9(10)6-17(8)11(18)2-3-19-7-12(13,14)15/h8-10,16H,2-7H2,1H3 |
| InChIKey | NWBIIJIITKZOPD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|