C13H22F2N2O2 — CID 103209597
3-(2,2-difluoroethoxy)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one (PubChem CID 103209597) has the molecular formula C13H22F2N2O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 103209597 |
| Molecular Formula | C13H22F2N2O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
| SMILES | CCC1C2CNCC2CN1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C13H22F2N2O2/c1-2-11-10-6-16-5-9(10)7-17(11)13(18)3-4-19-8-12(14)15/h9-12,16H,2-8H2,1H3 |
| InChIKey | VCMDTNBBKUXSBA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|