C14H23F2NO4 — CID 103209836
tert-butyl (2R)-1-[3-(2,2-difluoroethoxy)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 103209836) has the molecular formula C14H23F2NO4 and a molecular weight of 307.34 g/mol. Its IUPAC name is tert-butyl (2R)-1-[3-(2,2-difluoroethoxy)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[3-(2,2-difluoroethoxy)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 103209836 |
| Molecular Formula | C14H23F2NO4 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl (2R)-1-[3-(2,2-difluoroethoxy)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C14H23F2NO4/c1-14(2,3)21-13(19)10-5-4-7-17(10)12(18)6-8-20-9-11(15)16/h10-11H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | HUONUGWVEPGZEF-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|