C12H14F2N2O3S — CID 103209880
3-(2,2-difluoroethoxy)-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 103209880) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 103209880 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCOCC(F)F)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C12H14F2N2O3S/c13-10(14)8-19-6-4-11(18)16-12-15-7-9(20-12)3-1-2-5-17/h7,10,17H,2,4-6,8H2,(H,15,16,18) |
| InChIKey | YLMBXGKRUPPSSU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|