About 1-phenylhexa-2,4-diyn-1-one
1-phenylhexa-2,4-diyn-1-one (PubChem CID 10321) has the molecular formula C12H8O
and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-phenylhexa-2,4-diyn-1-one.
Molecular Properties
| Compound Name | 1-phenylhexa-2,4-diyn-1-one |
| PubChem CID | 10321 |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 1-phenylhexa-2,4-diyn-1-one |
| SMILES | CC#CC#CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H8O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,1H3 |
| InChIKey | RAZOKRUZEQERLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhexa-2,4-diyn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhexa-2,4-diyn-1-one?
The IUPAC name of 1-phenylhexa-2,4-diyn-1-one (CID 10321) is 1-phenylhexa-2,4-diyn-1-one.
What is the SMILES notation for 1-phenylhexa-2,4-diyn-1-one?
The canonical SMILES for 1-phenylhexa-2,4-diyn-1-one is CC#CC#CC(=O)c1ccccc1.
What is the InChIKey of 1-phenylhexa-2,4-diyn-1-one?
The InChIKey is RAZOKRUZEQERLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,1H3.
What are the key properties of 1-phenylhexa-2,4-diyn-1-one?
1-phenylhexa-2,4-diyn-1-one has a molecular weight of 168.19 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhexa-2,4-diyn-1-one is sourced from PubChem (CID 10321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).