C12H17F3N2O4 — CID 103210010
3,3-dimethyl-4-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 103210010) has the molecular formula C12H17F3N2O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 3,3-dimethyl-4-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-4-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 103210010 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3,3-dimethyl-4-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1nnc(CCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C12H17F3N2O4/c1-11(2,6-10(18)19)5-9-17-16-8(21-9)3-4-20-7-12(13,14)15/h3-7H2,1-2H3,(H,18,19) |
| InChIKey | DXAIIAPXHGGUCP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|