C12H18F2N2O4 — CID 103210011
4-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid (PubChem CID 103210011) has the molecular formula C12H18F2N2O4 and a molecular weight of 292.28 g/mol. Its IUPAC name is 4-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 4-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103210011 |
| Molecular Formula | C12H18F2N2O4 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1nnc(CCOCC(F)F)o1 |
| InChI | InChI=1S/C12H18F2N2O4/c1-12(2,6-11(17)18)5-10-16-15-9(20-10)3-4-19-7-8(13)14/h8H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | XQRNILUMQUITSI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|