About 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol
1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103210300) has the molecular formula C9H12F3NO2
and a molecular weight of 223.19 g/mol. Its IUPAC name is 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
Molecular Properties
| Compound Name | 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| PubChem CID | 103210300 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)(F)F)c1cc[nH]c1 |
| InChI | InChI=1S/C9H12F3NO2/c10-9(11,12)6-15-4-2-8(14)7-1-3-13-5-7/h1,3,5,8,13-14H,2,4,6H2 |
| InChIKey | QWSSQQXXNPTIPG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol?
The IUPAC name of 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (CID 103210300) is 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
What is the SMILES notation for 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol?
The canonical SMILES for 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol is OC(CCOCC(F)(F)F)c1cc[nH]c1.
What is the InChIKey of 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol?
The InChIKey is QWSSQQXXNPTIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO2/c10-9(11,12)6-15-4-2-8(14)7-1-3-13-5-7/h1,3,5,8,13-14H,2,4,6H2.
What are the key properties of 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol?
1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol has a molecular weight of 223.19 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol is sourced from PubChem (CID 103210300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).