About 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol
3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol (PubChem CID 103210301) has the molecular formula C9H13F2NO2
and a molecular weight of 205.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol |
| PubChem CID | 103210301 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cc[nH]c1 |
| InChI | InChI=1S/C9H13F2NO2/c10-9(11)6-14-4-2-8(13)7-1-3-12-5-7/h1,3,5,8-9,12-13H,2,4,6H2 |
| InChIKey | XICWELINTQQPFY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol?
The IUPAC name of 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol (CID 103210301) is 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol?
The canonical SMILES for 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol is OC(CCOCC(F)F)c1cc[nH]c1.
What is the InChIKey of 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol?
The InChIKey is XICWELINTQQPFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2/c10-9(11)6-14-4-2-8(13)7-1-3-12-5-7/h1,3,5,8-9,12-13H,2,4,6H2.
What are the key properties of 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol?
3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol has a molecular weight of 205.20 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-1-(1H-pyrrol-3-yl)propan-1-ol is sourced from PubChem (CID 103210301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).