C14H18F2N2O3 — CID 103210429
6-[3-(2,2-difluoroethoxy)-1-hydroxypropyl]-3-methyl-1,4-dihydroquinazolin-2-one (PubChem CID 103210429) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 6-[3-(2,2-difluoroethoxy)-1-hydroxypropyl]-3-methyl-1,4-dihydroquinazolin-2-one.
| Compound Name | 6-[3-(2,2-difluoroethoxy)-1-hydroxypropyl]-3-methyl-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 103210429 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-[3-(2,2-difluoroethoxy)-1-hydroxypropyl]-3-methyl-1,4-dihydroquinazolin-2-one |
| SMILES | CN1Cc2cc(C(O)CCOCC(F)F)ccc2NC1=O |
| InChI | InChI=1S/C14H18F2N2O3/c1-18-7-10-6-9(2-3-11(10)17-14(18)20)12(19)4-5-21-8-13(15)16/h2-3,6,12-13,19H,4-5,7-8H2,1H3,(H,17,20) |
| InChIKey | IONMGIIRCYQAQG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|