About 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole
2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole (PubChem CID 103210717) has the molecular formula C9H12ClF3N2O
and a molecular weight of 256.65 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole.
Molecular Properties
| Compound Name | 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole |
| PubChem CID | 103210717 |
| Molecular Formula | C9H12ClF3N2O |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole |
| SMILES | FC(F)(F)COCCC(Cl)Cc1ncc[nH]1 |
| InChI | InChI=1S/C9H12ClF3N2O/c10-7(5-8-14-2-3-15-8)1-4-16-6-9(11,12)13/h2-3,7H,1,4-6H2,(H,14,15) |
| InChIKey | WKBHHXWPETXHFI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole?
The IUPAC name of 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole (CID 103210717) is 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole.
What is the SMILES notation for 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole?
The canonical SMILES for 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole is FC(F)(F)COCCC(Cl)Cc1ncc[nH]1.
What is the InChIKey of 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole?
The InChIKey is WKBHHXWPETXHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClF3N2O/c10-7(5-8-14-2-3-15-8)1-4-16-6-9(11,12)13/h2-3,7H,1,4-6H2,(H,14,15).
What are the key properties of 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole?
2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole has a molecular weight of 256.65 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(2,2,2-trifluoroethoxy)butyl]-1H-imidazole is sourced from PubChem (CID 103210717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).