C7H12F3N3O3 — CID 103211492
N-(1-amino-1-hydroxyiminopropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103211492) has the molecular formula C7H12F3N3O3 and a molecular weight of 243.18 g/mol. Its IUPAC name is N-(1-amino-1-hydroxyiminopropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(1-amino-1-hydroxyiminopropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103211492 |
| Molecular Formula | C7H12F3N3O3 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-(1-amino-1-hydroxyiminopropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(NC(=O)COCC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C7H12F3N3O3/c1-4(6(11)13-15)12-5(14)2-16-3-7(8,9)10/h4,15H,2-3H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | AAPUTVJRLCLOSA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|