About 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide
3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide (PubChem CID 103211501) has the molecular formula C11H21F2N3O3
and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide |
| PubChem CID | 103211501 |
| Molecular Formula | C11H21F2N3O3 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide |
| SMILES | CCC(CC)(NC(=O)CCOCC(F)F)C(N)=NO |
| InChI | InChI=1S/C11H21F2N3O3/c1-3-11(4-2,10(14)16-18)15-9(17)5-6-19-7-8(12)13/h8,18H,3-7H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | ZYEJSQSXXNMATL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide?
The IUPAC name of 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide (CID 103211501) is 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide?
The canonical SMILES for 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide is CCC(CC)(NC(=O)CCOCC(F)F)C(N)=NO.
What is the InChIKey of 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide?
The InChIKey is ZYEJSQSXXNMATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2N3O3/c1-3-11(4-2,10(14)16-18)15-9(17)5-6-19-7-8(12)13/h8,18H,3-7H2,1-2H3,(H2,14,16)(H,15,17).
What are the key properties of 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide?
3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide has a molecular weight of 281.30 g/mol, XLogP of 1.08, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]propanamide is sourced from PubChem (CID 103211501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).