C11H19F3N4O3 — CID 103211509
N-[4-(N'-hydroxycarbamimidoyl)-1-methylpiperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103211509) has the molecular formula C11H19F3N4O3 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[4-(N'-hydroxycarbamimidoyl)-1-methylpiperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[4-(N'-hydroxycarbamimidoyl)-1-methylpiperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103211509 |
| Molecular Formula | C11H19F3N4O3 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[4-(N'-hydroxycarbamimidoyl)-1-methylpiperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CN1CCC(NC(=O)COCC(F)(F)F)(C(N)=NO)CC1 |
| InChI | InChI=1S/C11H19F3N4O3/c1-18-4-2-10(3-5-18,9(15)17-20)16-8(19)6-21-7-11(12,13)14/h20H,2-7H2,1H3,(H2,15,17)(H,16,19) |
| InChIKey | WVCUEBKHNGCXJN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|