C8H14F3N3O3 — CID 103211564
N-(4-amino-4-hydroxyiminobutan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103211564) has the molecular formula C8H14F3N3O3 and a molecular weight of 257.21 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103211564 |
| Molecular Formula | C8H14F3N3O3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(CC(N)=NO)NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O3/c1-5(2-6(12)14-16)13-7(15)3-17-4-8(9,10)11/h5,16H,2-4H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | FXVZKWBOGLTOMX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|