C10H9F3N2O4S — CID 103211920
(E)-3-[2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 103211920) has the molecular formula C10H9F3N2O4S and a molecular weight of 310.25 g/mol. Its IUPAC name is (E)-3-[2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103211920 |
| Molecular Formula | C10H9F3N2O4S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (E)-3-[2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC(=O)COCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H9F3N2O4S/c11-10(12,13)5-19-4-7(16)15-9-14-3-6(20-9)1-2-8(17)18/h1-3H,4-5H2,(H,17,18)(H,14,15,16)/b2-1+ |
| InChIKey | VRQBNRHVIVBYOO-OWOJBTEDSA-N |
| XLogP | 1.76 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|