C11H11F3N2O4S — CID 103211921
(E)-3-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 103211921) has the molecular formula C11H11F3N2O4S and a molecular weight of 324.28 g/mol. Its IUPAC name is (E)-3-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103211921 |
| Molecular Formula | C11H11F3N2O4S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (E)-3-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC(=O)CCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C11H11F3N2O4S/c12-11(13,14)6-20-4-3-8(17)16-10-15-5-7(21-10)1-2-9(18)19/h1-2,5H,3-4,6H2,(H,18,19)(H,15,16,17)/b2-1+ |
| InChIKey | RUEZIROSKZMLMK-OWOJBTEDSA-N |
| XLogP | 2.15 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|