C11H12F2N2O4S — CID 103211922
(E)-3-[2-[3-(2,2-difluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 103211922) has the molecular formula C11H12F2N2O4S and a molecular weight of 306.29 g/mol. Its IUPAC name is (E)-3-[2-[3-(2,2-difluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[3-(2,2-difluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103211922 |
| Molecular Formula | C11H12F2N2O4S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (E)-3-[2-[3-(2,2-difluoroethoxy)propanoylamino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC(=O)CCOCC(F)F)s1 |
| InChI | InChI=1S/C11H12F2N2O4S/c12-8(13)6-19-4-3-9(16)15-11-14-5-7(20-11)1-2-10(17)18/h1-2,5,8H,3-4,6H2,(H,17,18)(H,14,15,16)/b2-1+ |
| InChIKey | QSKAARZVQAUIRZ-OWOJBTEDSA-N |
| XLogP | 1.85 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|