C12H12F3NO4S — CID 103211927
(E)-3-[5-[[[2-(2,2,2-trifluoroethoxy)acetyl]amino]methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 103211927) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is (E)-3-[5-[[[2-(2,2,2-trifluoroethoxy)acetyl]amino]methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[[2-(2,2,2-trifluoroethoxy)acetyl]amino]methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103211927 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (E)-3-[5-[[[2-(2,2,2-trifluoroethoxy)acetyl]amino]methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CNC(=O)COCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H12F3NO4S/c13-12(14,15)7-20-6-10(17)16-5-9-2-1-8(21-9)3-4-11(18)19/h1-4H,5-7H2,(H,16,17)(H,18,19)/b4-3+ |
| InChIKey | OPAGOFSOPPHZRU-ONEGZZNKSA-N |
| XLogP | 2.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|