C10H9ClIN3O — CID 103211960
1-[5-(3-chloro-4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine (PubChem CID 103211960) has the molecular formula C10H9ClIN3O and a molecular weight of 349.56 g/mol. Its IUPAC name is 1-[5-(3-chloro-4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(3-chloro-4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103211960 |
| Molecular Formula | C10H9ClIN3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 1-[5-(3-chloro-4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine |
| SMILES | CNCc1nnc(-c2ccc(I)c(Cl)c2)o1 |
| InChI | InChI=1S/C10H9ClIN3O/c1-13-5-9-14-15-10(16-9)6-2-3-8(12)7(11)4-6/h2-4,13H,5H2,1H3 |
| InChIKey | HCVZXPKANTVHEG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|