C9H13BrF3NO3 — CID 103212312
1-[2-(bromomethyl)morpholin-4-yl]-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103212312) has the molecular formula C9H13BrF3NO3 and a molecular weight of 320.11 g/mol. Its IUPAC name is 1-[2-(bromomethyl)morpholin-4-yl]-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-[2-(bromomethyl)morpholin-4-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103212312 |
| Molecular Formula | C9H13BrF3NO3 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 1-[2-(bromomethyl)morpholin-4-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)(F)F)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C9H13BrF3NO3/c10-3-7-4-14(1-2-17-7)8(15)5-16-6-9(11,12)13/h7H,1-6H2 |
| InChIKey | JMKHYQUAUBRYDP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|