C10H15ClF3NO2 — CID 103212396
N-[(2-chlorocyclopentyl)methyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103212396) has the molecular formula C10H15ClF3NO2 and a molecular weight of 273.68 g/mol. Its IUPAC name is N-[(2-chlorocyclopentyl)methyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[(2-chlorocyclopentyl)methyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103212396 |
| Molecular Formula | C10H15ClF3NO2 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-[(2-chlorocyclopentyl)methyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NCC1CCCC1Cl |
| InChI | InChI=1S/C10H15ClF3NO2/c11-8-3-1-2-7(8)4-15-9(16)5-17-6-10(12,13)14/h7-8H,1-6H2,(H,15,16) |
| InChIKey | CNYWXJCTWDHTNS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|