C8H12Br2F3NO2 — CID 103212609
N-(1,3-dibromo-2-methylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103212609) has the molecular formula C8H12Br2F3NO2 and a molecular weight of 370.99 g/mol. Its IUPAC name is N-(1,3-dibromo-2-methylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(1,3-dibromo-2-methylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103212609 |
| Molecular Formula | C8H12Br2F3NO2 |
| Molecular Weight | 370.99 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | N-(1,3-dibromo-2-methylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(CBr)(CBr)NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C8H12Br2F3NO2/c1-7(3-9,4-10)14-6(15)2-16-5-8(11,12)13/h2-5H2,1H3,(H,14,15) |
| InChIKey | SGJOLRZEHPVFHP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.99 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|