C10H14ClF2NO2 — CID 103213141
2-(3-chloropropyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazole (PubChem CID 103213141) has the molecular formula C10H14ClF2NO2 and a molecular weight of 253.68 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazole.
| Compound Name | 2-(3-chloropropyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 103213141 |
| Molecular Formula | C10H14ClF2NO2 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(3-chloropropyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazole |
| SMILES | FC(F)COCCc1cnc(CCCCl)o1 |
| InChI | InChI=1S/C10H14ClF2NO2/c11-4-1-2-10-14-6-8(16-10)3-5-15-7-9(12)13/h6,9H,1-5,7H2 |
| InChIKey | CHNLBSZGAPARGT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|