C22H32ClN7O — CID 10321323
2-chloro-4-[[4-(cycloheptylamino)-6-[(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 10321323) has the molecular formula C22H32ClN7O and a molecular weight of 446.00 g/mol. Its IUPAC name is 2-chloro-4-[[4-(cycloheptylamino)-6-[(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 2-chloro-4-[[4-(cycloheptylamino)-6-[(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 10321323 |
| Molecular Formula | C22H32ClN7O |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-chloro-4-[[4-(cycloheptylamino)-6-[(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CN1CCC(Nc2nc(Nc3ccc(O)c(Cl)c3)nc(NC3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C22H32ClN7O/c1-30-12-10-16(11-13-30)25-21-27-20(24-15-6-4-2-3-5-7-15)28-22(29-21)26-17-8-9-19(31)18(23)14-17/h8-9,14-16,31H,2-7,10-13H2,1H3,(H3,24,25,26,27,28,29) |
| InChIKey | KFRHKLLPHATPNW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|