About 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride
4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride (PubChem CID 10321324) has the molecular formula C23H28ClN3O2S
and a molecular weight of 446.02 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride.
Molecular Properties
| Compound Name | 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride |
| PubChem CID | 10321324 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2ccc3nccc(N4CCCNCC4)c3c2)cc1.Cl |
| InChI | InChI=1S/C23H27N3O2S.ClH/c1-17(2)18-4-6-19(7-5-18)29(27,28)20-8-9-22-21(16-20)23(10-12-25-22)26-14-3-11-24-13-15-26;/h4-10,12,16-17,24H,3,11,13-15H2,1-2H3;1H |
| InChIKey | AFIIZISMCSMMRZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride?
The IUPAC name of 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride (CID 10321324) is 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride.
What is the SMILES notation for 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride?
The canonical SMILES for 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride is CC(C)c1ccc(S(=O)(=O)c2ccc3nccc(N4CCCNCC4)c3c2)cc1.Cl.
What is the InChIKey of 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride?
The InChIKey is AFIIZISMCSMMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2S.ClH/c1-17(2)18-4-6-19(7-5-18)29(27,28)20-8-9-22-21(16-20)23(10-12-25-22)26-14-3-11-24-13-15-26;/h4-10,12,16-17,24H,3,11,13-15H2,1-2H3;1H.
What are the key properties of 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride?
4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride has a molecular weight of 446.02 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-yl)-6-(4-propan-2-ylphenyl)sulfonylquinoline;hydrochloride is sourced from PubChem (CID 10321324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).